C24H30ClF3N2O — CID 45260939
1-[4-(2,3-dihydro-1H-inden-5-yloxy)butyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride (PubChem CID 45260939) has the molecular formula C24H30ClF3N2O and a molecular weight of 454.96 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1H-inden-5-yloxy)butyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride.
| Compound Name | 1-[4-(2,3-dihydro-1H-inden-5-yloxy)butyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 45260939 |
| Molecular Formula | C24H30ClF3N2O |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-[4-(2,3-dihydro-1H-inden-5-yloxy)butyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(N2CCN(CCCCOc3ccc4c(c3)CCC4)CC2)c1 |
| InChI | InChI=1S/C24H29F3N2O.ClH/c25-24(26,27)21-7-4-8-22(18-21)29-14-12-28(13-15-29)11-1-2-16-30-23-10-9-19-5-3-6-20(19)17-23;/h4,7-10,17-18H,1-3,5-6,11-16H2;1H |
| InChIKey | ONGNPNJOMONTTR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|