C24H28F3N3O2 — CID 162663239
2-methyl-7-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]-3,4-dihydroisoquinolin-1-one (PubChem CID 162663239) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-methyl-7-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-methyl-7-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 162663239 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-methyl-7-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]-3,4-dihydroisoquinolin-1-one |
| SMILES | CN1CCc2ccc(OCCCN3CCN(c4cccc(C(F)(F)F)c4)CC3)cc2C1=O |
| InChI | InChI=1S/C24H28F3N3O2/c1-28-10-8-18-6-7-21(17-22(18)23(28)31)32-15-3-9-29-11-13-30(14-12-29)20-5-2-4-19(16-20)24(25,26)27/h2,4-7,16-17H,3,8-15H2,1H3 |
| InChIKey | OHRZGEKCBGRRIB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|