C29H35F3N2O3 — CID 86275196
7-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 86275196) has the molecular formula C29H35F3N2O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is 7-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one.
| Compound Name | 7-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 86275196 |
| Molecular Formula | C29H35F3N2O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 7-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | O=C1CC2(CCCCC2)Oc2cc(OCCCCN3CCN(c4cccc(C(F)(F)F)c4)CC3)ccc21 |
| InChI | InChI=1S/C29H35F3N2O3/c30-29(31,32)22-7-6-8-23(19-22)34-16-14-33(15-17-34)13-4-5-18-36-24-9-10-25-26(35)21-28(37-27(25)20-24)11-2-1-3-12-28/h6-10,19-20H,1-5,11-18,21H2 |
| InChIKey | HFKDGCVECQYZSP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|