C29H35N3O3S — CID 86275199
7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 86275199) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is 7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one.
| Compound Name | 7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 86275199 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | O=C1CC2(CCCCC2)Oc2cc(OCCCCN3CCN(c4nsc5ccccc45)CC3)ccc21 |
| InChI | InChI=1S/C29H35N3O3S/c33-25-21-29(12-4-1-5-13-29)35-26-20-22(10-11-23(25)26)34-19-7-6-14-31-15-17-32(18-16-31)28-24-8-2-3-9-27(24)36-30-28/h2-3,8-11,20H,1,4-7,12-19,21H2 |
| InChIKey | MVVMJBIMCXARLG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|