C24H32N4O2S — CID 44518811
3-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propyl]-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 44518811) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is 3-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propyl]-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propyl]-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 44518811 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 3-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propyl]-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1CC2(CCCCC2)CC(=O)N1CCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C24H32N4O2S/c29-21-17-24(9-4-1-5-10-24)18-22(30)28(21)12-6-11-26-13-15-27(16-14-26)23-19-7-2-3-8-20(19)31-25-23/h2-3,7-8H,1,4-6,9-18H2 |
| InChIKey | IWCHJZZMXONPHJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|