C22H30N6O2S — CID 168985915
(9aR)-7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1,2,3,4,9,9a-hexahydropyrazino[1,2-c]pyrimidine-6,8-dione (PubChem CID 168985915) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is (9aR)-7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1,2,3,4,9,9a-hexahydropyrazino[1,2-c]pyrimidine-6,8-dione.
| Compound Name | (9aR)-7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1,2,3,4,9,9a-hexahydropyrazino[1,2-c]pyrimidine-6,8-dione |
|---|---|
| PubChem CID | 168985915 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (9aR)-7-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1,2,3,4,9,9a-hexahydropyrazino[1,2-c]pyrimidine-6,8-dione |
| SMILES | O=C1C[C@@H]2CNCCN2C(=O)N1CCCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C22H30N6O2S/c29-20-15-17-16-23-7-10-27(17)22(30)28(20)9-4-3-8-25-11-13-26(14-12-25)21-18-5-1-2-6-19(18)31-24-21/h1-2,5-6,17,23H,3-4,7-16H2/t17-/m1/s1 |
| InChIKey | XFFBSSGIVVXSDA-QGZVFWFLSA-N |
| XLogP | 1.82 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|