C24H34N4O2S — CID 13232494
1-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4,4-diethylpiperidine-2,6-dione (PubChem CID 13232494) has the molecular formula C24H34N4O2S and a molecular weight of 442.63 g/mol. Its IUPAC name is 1-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4,4-diethylpiperidine-2,6-dione.
| Compound Name | 1-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4,4-diethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 13232494 |
| Molecular Formula | C24H34N4O2S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4,4-diethylpiperidine-2,6-dione |
| SMILES | CCC1(CC)CC(=O)N(CCCCN2CCN(c3nsc4ccccc34)CC2)C(=O)C1 |
| InChI | InChI=1S/C24H34N4O2S/c1-3-24(4-2)17-21(29)28(22(30)18-24)12-8-7-11-26-13-15-27(16-14-26)23-19-9-5-6-10-20(19)31-25-23/h5-6,9-10H,3-4,7-8,11-18H2,1-2H3 |
| InChIKey | WZYPWDYYXNYUJC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|