C25H29N5O3S — CID 10096660
ethyl 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-oxoindazole-1-carboxylate (PubChem CID 10096660) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is ethyl 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-oxoindazole-1-carboxylate.
| Compound Name | ethyl 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-oxoindazole-1-carboxylate |
|---|---|
| PubChem CID | 10096660 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | ethyl 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-oxoindazole-1-carboxylate |
| SMILES | CCOC(=O)n1c2ccccc2c(=O)n1CCCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C25H29N5O3S/c1-2-33-25(32)30-21-11-5-3-9-19(21)24(31)29(30)14-8-7-13-27-15-17-28(18-16-27)23-20-10-4-6-12-22(20)34-26-23/h3-6,9-12H,2,7-8,13-18H2,1H3 |
| InChIKey | FWRZTTGLYSGBCQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|