C23H29N5O2S — CID 10599194
2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-methoxybenzamide (PubChem CID 10599194) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-methoxybenzamide.
| Compound Name | 2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 10599194 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCCCN2CCN(c3nsc4ccccc34)CC2)c1N |
| InChI | InChI=1S/C23H29N5O2S/c1-30-19-9-6-8-18(21(19)24)23(29)25-11-4-5-12-27-13-15-28(16-14-27)22-17-7-2-3-10-20(17)31-26-22/h2-3,6-10H,4-5,11-16,24H2,1H3,(H,25,29) |
| InChIKey | MDAWBIVBCZPWJB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|