C24H30ClN5O2S — CID 45259400
4-acetamido-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride (PubChem CID 45259400) has the molecular formula C24H30ClN5O2S and a molecular weight of 488.06 g/mol. Its IUPAC name is 4-acetamido-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride.
| Compound Name | 4-acetamido-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 45259400 |
| Molecular Formula | C24H30ClN5O2S |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 4-acetamido-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(C(=O)NCCCCN2CCN(c3nsc4ccccc34)CC2)cc1.Cl |
| InChI | InChI=1S/C24H29N5O2S.ClH/c1-18(30)26-20-10-8-19(9-11-20)24(31)25-12-4-5-13-28-14-16-29(17-15-28)23-21-6-2-3-7-22(21)32-27-23;/h2-3,6-11H,4-5,12-17H2,1H3,(H,25,31)(H,26,30);1H |
| InChIKey | BGTUOYIMVWLASS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|