C27H35N5O3S — CID 10506005
tert-butyl N-[6-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butylcarbamoyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]carbamate (PubChem CID 10506005) has the molecular formula C27H35N5O3S and a molecular weight of 515.63 g/mol. Its IUPAC name is tert-butyl N-[6-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butylcarbamoyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]carbamate.
| Compound Name | tert-butyl N-[6-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butylcarbamoyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]carbamate |
|---|---|
| PubChem CID | 10506005 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | tert-butyl N-[6-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butylcarbamoyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[13c]1[13cH][13cH][13cH][13cH][13c]1C(=O)NCCCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C27H35N5O3S/c1-27(2,3)35-26(34)29-22-12-6-4-10-20(22)25(33)28-14-8-9-15-31-16-18-32(19-17-31)24-21-11-5-7-13-23(21)36-30-24/h4-7,10-13H,8-9,14-19H2,1-3H3,(H,28,33)(H,29,34)/i4+1,6+1,10+1,12+1,20+1,22+1 |
| InChIKey | CQMYQTLFDMDIFH-NIKIWRNXSA-N |
| XLogP | 4.98 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|