C17H29N5O2 — CID 164715475
tert-butyl N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate (PubChem CID 164715475) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate |
|---|---|
| PubChem CID | 164715475 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | tert-butyl N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H29N5O2/c1-17(2,3)24-16(23)20-7-4-5-10-21-11-13-22(14-12-21)15-18-8-6-9-19-15/h6,8-9H,4-5,7,10-14H2,1-3H3,(H,20,23) |
| InChIKey | CAKDVNDSOBBNQV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|