C17H27N5O3 — CID 51217256
tert-butyl N-[4-oxo-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate (PubChem CID 51217256) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate |
|---|---|
| PubChem CID | 51217256 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl N-[4-oxo-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H27N5O3/c1-17(2,3)25-16(24)20-7-4-6-14(23)21-10-12-22(13-11-21)15-18-8-5-9-19-15/h5,8-9H,4,6-7,10-13H2,1-3H3,(H,20,24) |
| InChIKey | HXJRYEXGQKFDFO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|