C25H34N6O4 — CID 55673210
tert-butyl N-[4-oxo-4-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]anilino]butyl]carbamate (PubChem CID 55673210) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]anilino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]anilino]butyl]carbamate |
|---|---|
| PubChem CID | 55673210 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]anilino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ccc(CC(=O)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C25H34N6O4/c1-25(2,3)35-24(34)28-11-4-6-21(32)29-20-9-7-19(8-10-20)18-22(33)30-14-16-31(17-15-30)23-26-12-5-13-27-23/h5,7-10,12-13H,4,6,11,14-18H2,1-3H3,(H,28,34)(H,29,32) |
| InChIKey | MZGBDYNEOZMPPD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|