C16H25N3O5S — CID 9188430
tert-butyl N-[4-[4-(methylsulfamoyl)anilino]-4-oxobutyl]carbamate (PubChem CID 9188430) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(methylsulfamoyl)anilino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(methylsulfamoyl)anilino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 9188430 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | tert-butyl N-[4-[4-(methylsulfamoyl)anilino]-4-oxobutyl]carbamate |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)CCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O5S/c1-16(2,3)24-15(21)18-11-5-6-14(20)19-12-7-9-13(10-8-12)25(22,23)17-4/h7-10,17H,5-6,11H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | LJEVDPADNMTISX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|