C20H30N4O5S — CID 55968838
tert-butyl N-[4-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-4-oxobutyl]carbamate (PubChem CID 55968838) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55968838 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | tert-butyl N-[4-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylanilino]-4-oxobutyl]carbamate |
| SMILES | CN1CCC/C1=N\S(=O)(=O)c1ccc(NC(=O)CCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H30N4O5S/c1-20(2,3)29-19(26)21-13-5-8-18(25)22-15-9-11-16(12-10-15)30(27,28)23-17-7-6-14-24(17)4/h9-12H,5-8,13-14H2,1-4H3,(H,21,26)(H,22,25)/b23-17+ |
| InChIKey | MMUFZKLZCHEDJX-HAVVHWLPSA-N |
| XLogP | 2.74 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|