C15H23N3O5S — CID 118707459
tert-butyl N-[4-oxo-4-(4-sulfamoylanilino)butyl]carbamate (PubChem CID 118707459) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-(4-sulfamoylanilino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-(4-sulfamoylanilino)butyl]carbamate |
|---|---|
| PubChem CID | 118707459 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | tert-butyl N-[4-oxo-4-(4-sulfamoylanilino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23N3O5S/c1-15(2,3)23-14(20)17-10-4-5-13(19)18-11-6-8-12(9-7-11)24(16,21)22/h6-9H,4-5,10H2,1-3H3,(H,17,20)(H,18,19)(H2,16,21,22) |
| InChIKey | UZBQWPUZAIPTQN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|