C14H22N4O5S — CID 10784627
tert-butyl N-[3-oxo-3-[2-(4-sulfamoylphenyl)hydrazinyl]propyl]carbamate (PubChem CID 10784627) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[2-(4-sulfamoylphenyl)hydrazinyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[2-(4-sulfamoylphenyl)hydrazinyl]propyl]carbamate |
|---|---|
| PubChem CID | 10784627 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[2-(4-sulfamoylphenyl)hydrazinyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NNc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N4O5S/c1-14(2,3)23-13(20)16-9-8-12(19)18-17-10-4-6-11(7-5-10)24(15,21)22/h4-7,17H,8-9H2,1-3H3,(H,16,20)(H,18,19)(H2,15,21,22) |
| InChIKey | JAZUCZDEUDGTKX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|