C17H22N6O5S — CID 10645900
tert-butyl N-[2-oxo-2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]amino]ethyl]carbamate (PubChem CID 10645900) has the molecular formula C17H22N6O5S and a molecular weight of 422.47 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 10645900 |
| Molecular Formula | C17H22N6O5S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1nccc(Nc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C17H22N6O5S/c1-17(2,3)28-16(25)20-10-14(24)23-15-19-9-8-13(22-15)21-11-4-6-12(7-5-11)29(18,26)27/h4-9H,10H2,1-3H3,(H,20,25)(H2,18,26,27)(H2,19,21,22,23,24) |
| InChIKey | CXSBLQCOJXDUAV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 165.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |