C17H15N5O6S2 — CID 171988640
2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]sulfamoyl]benzoic acid (PubChem CID 171988640) has the molecular formula C17H15N5O6S2 and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 171988640 |
| Molecular Formula | C17H15N5O6S2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2-[[4-(4-sulfamoylanilino)pyrimidin-2-yl]sulfamoyl]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(Nc2ccnc(NS(=O)(=O)c3ccccc3C(=O)O)n2)cc1 |
| InChI | InChI=1S/C17H15N5O6S2/c18-29(25,26)12-7-5-11(6-8-12)20-15-9-10-19-17(21-15)22-30(27,28)14-4-2-1-3-13(14)16(23)24/h1-10H,(H,23,24)(H2,18,25,26)(H2,19,20,21,22) |
| InChIKey | UZJZLZUQEQPPLO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |