C22H25N5O4S — CID 122620241
2-[[2-[4-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 122620241) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-[[2-[4-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 122620241 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-[[2-[4-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CC(C)CCNS(=O)(=O)c1ccc(Nc2nccc(Nc3ccccc3C(=O)O)n2)cc1 |
| InChI | InChI=1S/C22H25N5O4S/c1-15(2)11-14-24-32(30,31)17-9-7-16(8-10-17)25-22-23-13-12-20(27-22)26-19-6-4-3-5-18(19)21(28)29/h3-10,12-13,15,24H,11,14H2,1-2H3,(H,28,29)(H2,23,25,26,27) |
| InChIKey | ZWUAXBNOZZIWOY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |