C25H25ClN6O7S — CID 10555371
2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]acetamide perchlorate (PubChem CID 10555371) has the molecular formula C25H25ClN6O7S and a molecular weight of 589.03 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]acetamide perchlorate.
| Compound Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]acetamide perchlorate |
|---|---|
| PubChem CID | 10555371 |
| Molecular Formula | C25H25ClN6O7S |
| Molecular Weight | 589.03 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]acetamide perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)Nc1nccc(Nc2ccc(S(N)(=O)=O)cc2)n1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H24N6O3S.ClHO4/c1-17-14-20(19-6-4-3-5-7-19)15-18(2)31(17)16-24(32)30-25-27-13-12-23(29-25)28-21-8-10-22(11-9-21)35(26,33)34;2-1(3,4)5/h3-15H,16H2,1-2H3,(H3-,26,27,28,29,30,32,33,34);(H,2,3,4,5) |
| InChIKey | KMNBNUGURPHYQD-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 223.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.03 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|