C23H26ClN3O7S — CID 10649726
2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide perchlorate (PubChem CID 10649726) has the molecular formula C23H26ClN3O7S and a molecular weight of 524.00 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide perchlorate.
| Compound Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide perchlorate |
|---|---|
| PubChem CID | 10649726 |
| Molecular Formula | C23H26ClN3O7S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide perchlorate |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1CC(=O)Nc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H25N3O3S.ClHO4/c1-3-20-14-18(17-8-6-5-7-9-17)15-21(4-2)26(20)16-23(27)25-19-10-12-22(13-11-19)30(24,28)29;2-1(3,4)5/h5-15H,3-4,16H2,1-2H3,(H2-,24,25,27,28,29);(H,2,3,4,5) |
| InChIKey | AWIFJIINDABCGI-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 185.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|