C21H21ClIN3O7S — CID 10651537
2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-iodo-4-sulfamoylphenyl)acetamide perchlorate (PubChem CID 10651537) has the molecular formula C21H21ClIN3O7S and a molecular weight of 621.84 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-iodo-4-sulfamoylphenyl)acetamide perchlorate.
| Compound Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-iodo-4-sulfamoylphenyl)acetamide perchlorate |
|---|---|
| PubChem CID | 10651537 |
| Molecular Formula | C21H21ClIN3O7S |
| Molecular Weight | 621.84 g/mol |
| Exact Mass | 620.98 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(2-iodo-4-sulfamoylphenyl)acetamide perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)Nc1ccc(S(N)(=O)=O)cc1I.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H20IN3O3S.ClHO4/c1-14-10-17(16-6-4-3-5-7-16)11-15(2)25(14)13-21(26)24-20-9-8-18(12-19(20)22)29(23,27)28;2-1(3,4)5/h3-12H,13H2,1-2H3,(H2-,23,24,26,27,28);(H,2,3,4,5) |
| InChIKey | YYAFSDXLEBNBAM-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 185.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.84 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|