C18H20ClN5O7S2 — CID 10625732
2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide perchlorate (PubChem CID 10625732) has the molecular formula C18H20ClN5O7S2 and a molecular weight of 517.97 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide perchlorate.
| Compound Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide perchlorate |
|---|---|
| PubChem CID | 10625732 |
| Molecular Formula | C18H20ClN5O7S2 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)/N=c1\sc(S(N)(=O)=O)nn1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H20N5O3S2.ClHO4/c1-12-9-15(14-7-5-4-6-8-14)10-13(2)23(12)11-16(24)20-17-22(3)21-18(27-17)28(19,25)26;2-1(3,4)5/h4-10H,11H2,1-3H3,(H2,19,25,26);(H,2,3,4,5)/q+1;/p-1/b20-17-; |
| InChIKey | UQUIVNVAMPCBLJ-BZHDPTRRSA-M |
| XLogP | -3.93 |
| TPSA | 203.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|