C28H30ClN2O4+ — CID 54607926
1-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)ethyl]-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate (PubChem CID 54607926) has the molecular formula C28H30ClN2O4+ and a molecular weight of 494.01 g/mol. Its IUPAC name is 1-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)ethyl]-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate.
| Compound Name | 1-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)ethyl]-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 54607926 |
| Molecular Formula | C28H30ClN2O4+ |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 1-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)ethyl]-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC[n+]1c(C)cc(-c2ccccc2)cc1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C28H30N2.ClHO4/c1-21-17-27(25-11-7-5-8-12-25)18-22(2)29(21)15-16-30-23(3)19-28(20-24(30)4)26-13-9-6-10-14-26;2-1(3,4)5/h5-14,17-20H,15-16H2,1-4H3;(H,2,3,4,5)/q+2;/p-1 |
| InChIKey | NIBCVWRXCHCQSR-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 100.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|