About 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate
6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate (PubChem CID 2834903) has the molecular formula C24H18ClNO4
and a molecular weight of 419.86 g/mol. Its IUPAC name is 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate.
Molecular Properties
| Compound Name | 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate |
| PubChem CID | 2834903 |
| Molecular Formula | C24H18ClNO4 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc2c3ccccc3c3ccccc3[n+]12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H18N.ClHO4/c1-17-15-19(18-9-3-2-4-10-18)16-24-22-13-6-5-11-20(22)21-12-7-8-14-23(21)25(17)24;2-1(3,4)5/h2-16H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KAOADJHPDGWMPN-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 96.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate?
The IUPAC name of 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate (CID 2834903) is 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate.
What is the SMILES notation for 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate?
The canonical SMILES for 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate is Cc1cc(-c2ccccc2)cc2c3ccccc3c3ccccc3[n+]12.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate?
The InChIKey is KAOADJHPDGWMPN-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H18N.ClHO4/c1-17-15-19(18-9-3-2-4-10-18)16-24-22-13-6-5-11-20(22)21-12-7-8-14-23(21)25(17)24;2-1(3,4)5/h2-16H,1H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate?
6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate has a molecular weight of 419.86 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-8-phenylpyrido[1,2-f]phenanthridin-5-ium perchlorate is sourced from PubChem (CID 2834903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).