C25H20ClNO5S — CID 10696142
2,6-dimethyl-1-phenoxathiin-2-yl-4-phenylpyridin-1-ium perchlorate (PubChem CID 10696142) has the molecular formula C25H20ClNO5S and a molecular weight of 481.96 g/mol. Its IUPAC name is 2,6-dimethyl-1-phenoxathiin-2-yl-4-phenylpyridin-1-ium perchlorate.
| Compound Name | 2,6-dimethyl-1-phenoxathiin-2-yl-4-phenylpyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 10696142 |
| Molecular Formula | C25H20ClNO5S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2,6-dimethyl-1-phenoxathiin-2-yl-4-phenylpyridin-1-ium perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1-c1ccc2c(c1)Sc1ccccc1O2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H20NOS.ClHO4/c1-17-14-20(19-8-4-3-5-9-19)15-18(2)26(17)21-12-13-23-25(16-21)28-24-11-7-6-10-22(24)27-23;2-1(3,4)5/h3-16H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HYSGKIQNAZWKLA-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|