C24H20N+ — CID 3702073
2-methyl-1,4,6-triphenylpyridin-1-ium (PubChem CID 3702073) has the molecular formula C24H20N+ and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-methyl-1,4,6-triphenylpyridin-1-ium.
| Compound Name | 2-methyl-1,4,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 3702073 |
| Molecular Formula | C24H20N+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-methyl-1,4,6-triphenylpyridin-1-ium |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1ccccc1 |
| InChI | InChI=1S/C24H20N/c1-19-17-22(20-11-5-2-6-12-20)18-24(21-13-7-3-8-14-21)25(19)23-15-9-4-10-16-23/h2-18H,1H3/q+1 |
| InChIKey | GCXFNYYWVNGMJM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|