C25H20NO2+ — CID 3730818
1-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxylic acid (PubChem CID 3730818) has the molecular formula C25H20NO2+ and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxylic acid.
| Compound Name | 1-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 3730818 |
| Molecular Formula | C25H20NO2+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxylic acid |
| SMILES | Cc1ccc(-[n+]2c(C(=O)O)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19NO2/c1-18-12-14-22(15-13-18)26-23(20-10-6-3-7-11-20)16-21(17-24(26)25(27)28)19-8-4-2-5-9-19/h2-17H,1H3/p+1 |
| InChIKey | ZWCXRJAIRWLDKD-UHFFFAOYSA-O |
| XLogP | 5.30 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|