C29H23ClN2O4 — CID 12627150
4-(4-methylphenyl)-2,6-diphenyl-1-pyridin-2-ylpyridin-1-ium perchlorate (PubChem CID 12627150) has the molecular formula C29H23ClN2O4 and a molecular weight of 498.97 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2,6-diphenyl-1-pyridin-2-ylpyridin-1-ium perchlorate.
| Compound Name | 4-(4-methylphenyl)-2,6-diphenyl-1-pyridin-2-ylpyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 12627150 |
| Molecular Formula | C29H23ClN2O4 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 4-(4-methylphenyl)-2,6-diphenyl-1-pyridin-2-ylpyridin-1-ium perchlorate |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)[n+](-c3ccccn3)c(-c3ccccc3)c2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H23N2.ClHO4/c1-22-15-17-23(18-16-22)26-20-27(24-10-4-2-5-11-24)31(29-14-8-9-19-30-29)28(21-26)25-12-6-3-7-13-25;2-1(3,4)5/h2-21H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | DCZBYCMWBSSEGG-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|