C30H23N2+ — CID 4267923
2,4-diphenyl-1-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium (PubChem CID 4267923) has the molecular formula C30H23N2+ and a molecular weight of 411.53 g/mol. Its IUPAC name is 2,4-diphenyl-1-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium.
| Compound Name | 2,4-diphenyl-1-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium |
|---|---|
| PubChem CID | 4267923 |
| Molecular Formula | C30H23N2+ |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2,4-diphenyl-1-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium |
| SMILES | c1ccc(-c2cc(-c3ccccc3)[n+](-c3ccccn3)c3c2CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C30H23N2/c1-3-11-22(12-4-1)27-21-28(24-14-5-2-6-15-24)32(29-17-9-10-20-31-29)30-25-16-8-7-13-23(25)18-19-26(27)30/h1-17,20-21H,18-19H2/q+1 |
| InChIKey | KHERNJXCGXRTGO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|