C27H21F3N2O3S — CID 44888296
2-pyridin-2-yl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate (PubChem CID 44888296) has the molecular formula C27H21F3N2O3S and a molecular weight of 510.54 g/mol. Its IUPAC name is 2-pyridin-2-yl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate.
| Compound Name | 2-pyridin-2-yl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888296 |
| Molecular Formula | C27H21F3N2O3S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 2-pyridin-2-yl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-[n+]2c3c(cc4c2-c2ccccc2CC4)CCc2ccccc2-3)nc1 |
| InChI | InChI=1S/C26H21N2.CHF3O3S/c1-3-9-22-18(7-1)12-14-20-17-21-15-13-19-8-2-4-10-23(19)26(21)28(25(20)22)24-11-5-6-16-27-24;2-1(3,4)8(5,6)7/h1-11,16-17H,12-15H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JUHFXGLZDCTQDO-UHFFFAOYSA-M |
| XLogP | 4.94 |
| TPSA | 73.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|