C13H13F6NO7S4 — CID 135480231
(E)-hydroxy-(4-methylsulfoniumylidene-1,2-dihydro-3-benzothiepin-5-ylidene)azanium;bis(trifluoromethanesulfonate) (PubChem CID 135480231) has the molecular formula C13H13F6NO7S4 and a molecular weight of 537.50 g/mol. Its IUPAC name is (E)-hydroxy-(4-methylsulfoniumylidene-1,2-dihydro-3-benzothiepin-5-ylidene)azanium;bis(trifluoromethanesulfonate).
| Compound Name | (E)-hydroxy-(4-methylsulfoniumylidene-1,2-dihydro-3-benzothiepin-5-ylidene)azanium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 135480231 |
| Molecular Formula | C13H13F6NO7S4 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 536.95 |
| IUPAC Name | (E)-hydroxy-(4-methylsulfoniumylidene-1,2-dihydro-3-benzothiepin-5-ylidene)azanium;bis(trifluoromethanesulfonate) |
| SMILES | C/[S+]=C1\SCCc2ccccc2\C1=[NH+]/O.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H11NOS2.2CHF3O3S/c1-14-11-10(12-13)9-5-3-2-4-8(9)6-7-15-11;2*2-1(3,4)8(5,6)7/h2-5H,6-7H2,1H3;2*(H,5,6,7)/b12-10+;; |
| InChIKey | YXIMAUHRGBWCMN-PFNYCKIMSA-N |
| XLogP | 0.18 |
| TPSA | 148.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|