C10H13O3S- — CID 19699408
2,3-dihydro-1H-indene;methanesulfonate (PubChem CID 19699408) has the molecular formula C10H13O3S- and a molecular weight of 213.28 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;methanesulfonate.
| Compound Name | 2,3-dihydro-1H-indene;methanesulfonate |
|---|---|
| PubChem CID | 19699408 |
| Molecular Formula | C10H13O3S- |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2,3-dihydro-1H-indene;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.CH4O3S/c1-2-5-9-7-3-6-8(9)4-1;1-5(2,3)4/h1-2,4-5H,3,6-7H2;1H3,(H,2,3,4)/p-1 |
| InChIKey | IZSYLNSLEMYLGC-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|