C9H14Cl4 — CID 175293615
2,3-dihydro-1H-indene;tetrahydrochloride (PubChem CID 175293615) has the molecular formula C9H14Cl4 and a molecular weight of 264.02 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;tetrahydrochloride.
| Compound Name | 2,3-dihydro-1H-indene;tetrahydrochloride |
|---|---|
| PubChem CID | 175293615 |
| Molecular Formula | C9H14Cl4 |
| Molecular Weight | 264.02 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 2,3-dihydro-1H-indene;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.4ClH/c1-2-5-9-7-3-6-8(9)4-1;;;;/h1-2,4-5H,3,6-7H2;4*1H |
| InChIKey | RODAXXJGMXNDSW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.02 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |