C19H20Zr — CID 159786889
bis(cyclopenta-1,3-diene);2,3-dihydro-1H-indene;zirconium(2+) (PubChem CID 159786889) has the molecular formula C19H20Zr and a molecular weight of 339.59 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);2,3-dihydro-1H-indene;zirconium(2+).
| Compound Name | bis(cyclopenta-1,3-diene);2,3-dihydro-1H-indene;zirconium(2+) |
|---|---|
| PubChem CID | 159786889 |
| Molecular Formula | C19H20Zr |
| Molecular Weight | 339.59 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | bis(cyclopenta-1,3-diene);2,3-dihydro-1H-indene;zirconium(2+) |
| SMILES | [Zr+2].c1cc[cH-]c1.c1cc[cH-]c1.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.2C5H5.Zr/c1-2-5-9-7-3-6-8(9)4-1;2*1-2-4-5-3-1;/h1-2,4-5H,3,6-7H2;2*1-5H;/q;2*-1;+2 |
| InChIKey | NIBGNZQFOXTVAU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|