C15H26 — CID 143018675
ethane;6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 143018675) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is ethane;6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | ethane;6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 143018675 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | ethane;6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CC.CC.c1ccc2c(c1)CCCCC2 |
| InChI | InChI=1S/C11H14.2C2H6/c1-2-6-10-8-4-5-9-11(10)7-3-1;2*1-2/h4-5,8-9H,1-3,6-7H2;2*1-2H3 |
| InChIKey | MQFRCIBQPRDSEE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |