C14H22 — CID 91306466
2,3-dihydro-1H-indene;2,2-dimethylpropane (PubChem CID 91306466) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;2,2-dimethylpropane.
| Compound Name | 2,3-dihydro-1H-indene;2,2-dimethylpropane |
|---|---|
| PubChem CID | 91306466 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 2,3-dihydro-1H-indene;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.C5H12/c1-2-5-9-7-3-6-8(9)4-1;1-5(2,3)4/h1-2,4-5H,3,6-7H2;1-4H3 |
| InChIKey | VETIXKTVNRKDNV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |