C14H22O2 — CID 174902843
2-hydroperoxy-2-methylpropane;1,2,3,4-tetrahydronaphthalene (PubChem CID 174902843) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-hydroperoxy-2-methylpropane;1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-hydroperoxy-2-methylpropane;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 174902843 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-hydroperoxy-2-methylpropane;1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)(C)OO.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12.C4H10O2/c1-2-6-10-8-4-3-7-9(10)5-1;1-4(2,3)6-5/h1-2,5-6H,3-4,7-8H2;5H,1-3H3 |
| InChIKey | SXGMXXMLKOLHCJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|