C9H11BrO — CID 174544280
2,3-dihydro-1H-indene;hypobromous acid (PubChem CID 174544280) has the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;hypobromous acid.
| Compound Name | 2,3-dihydro-1H-indene;hypobromous acid |
|---|---|
| PubChem CID | 174544280 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2,3-dihydro-1H-indene;hypobromous acid |
| SMILES | OBr.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.BrHO/c1-2-5-9-7-3-6-8(9)4-1;1-2/h1-2,4-5H,3,6-7H2;2H |
| InChIKey | BWNKIWDLWDDMGZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |