2,3-dihydro-1H-indene;hypobromous acid

C9H11BrO — CID 174544280

IUPAC2,3-dihydro-1H-indene;hypobromous acid
SMILESOBr.c1ccc2c(c1)CCC2
InChIInChI=1S/C9H10.BrHO/c1-2-5-9-7-3-6-8(9)4-1;1-2/h1-2,4-5H,3,6-7H2;2H
InChIKeyBWNKIWDLWDDMGZ-UHFFFAOYSA-N
MW215.09 g/mol
LogP2.46
Rot. Bonds

About 2,3-dihydro-1H-indene;hypobromous acid

2,3-dihydro-1H-indene;hypobromous acid (PubChem CID 174544280) has the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;hypobromous acid.

Molecular Properties

Compound Name2,3-dihydro-1H-indene;hypobromous acid
PubChem CID174544280
Molecular FormulaC9H11BrO
Molecular Weight215.09 g/mol
Exact Mass214.00
IUPAC Name2,3-dihydro-1H-indene;hypobromous acid
SMILESOBr.c1ccc2c(c1)CCC2
InChIInChI=1S/C9H10.BrHO/c1-2-5-9-7-3-6-8(9)4-1;1-2/h1-2,4-5H,3,6-7H2;2H
InChIKeyBWNKIWDLWDDMGZ-UHFFFAOYSA-N
XLogP2.46
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.09
LogP ≤ 52.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,3-dihydro-1H-indene;hypobromous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydro-1H-indene;hypobromous acid?
The IUPAC name of 2,3-dihydro-1H-indene;hypobromous acid (CID 174544280) is 2,3-dihydro-1H-indene;hypobromous acid.
What is the SMILES notation for 2,3-dihydro-1H-indene;hypobromous acid?
The canonical SMILES for 2,3-dihydro-1H-indene;hypobromous acid is OBr.c1ccc2c(c1)CCC2.
What is the InChIKey of 2,3-dihydro-1H-indene;hypobromous acid?
The InChIKey is BWNKIWDLWDDMGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.BrHO/c1-2-5-9-7-3-6-8(9)4-1;1-2/h1-2,4-5H,3,6-7H2;2H.
What are the key properties of 2,3-dihydro-1H-indene;hypobromous acid?
2,3-dihydro-1H-indene;hypobromous acid has a molecular weight of 215.09 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indene;hypobromous acid is sourced from PubChem (CID 174544280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).