C11H14O3 — CID 175229813
carbonic acid;1,2,3,4-tetrahydronaphthalene (PubChem CID 175229813) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is carbonic acid;1,2,3,4-tetrahydronaphthalene.
| Compound Name | carbonic acid;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 175229813 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | carbonic acid;1,2,3,4-tetrahydronaphthalene |
| SMILES | O=C(O)O.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12.CH2O3/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3)4/h1-2,5-6H,3-4,7-8H2;(H2,2,3,4) |
| InChIKey | NLCYEEXCLUMEKU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |