C41H56 — CID 161259233
ethane;bis(1,2,3,4-tetrahydronaphthalene);tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (PubChem CID 161259233) has the molecular formula C41H56 and a molecular weight of 548.90 g/mol. Its IUPAC name is ethane;bis(1,2,3,4-tetrahydronaphthalene);tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene.
| Compound Name | ethane;bis(1,2,3,4-tetrahydronaphthalene);tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 161259233 |
| Molecular Formula | C41H56 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.44 |
| IUPAC Name | ethane;bis(1,2,3,4-tetrahydronaphthalene);tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| SMILES | CC.CC.CC.c1ccc2c(c1)CCCC2.c1ccc2c(c1)CCCC2.c1ccc2c(c1)CCc1ccccc1C2 |
| InChI | InChI=1S/C15H14.2C10H12.3C2H6/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1;2*1-2-6-10-8-4-3-7-9(10)5-1;3*1-2/h1-8H,9-11H2;2*1-2,5-6H,3-4,7-8H2;3*1-2H3 |
| InChIKey | VCIJDPYWUQZLLY-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |