C19H22 — CID 159163740
2,3-dihydro-1H-indene;2-methyl-2,3-dihydro-1H-indene (PubChem CID 159163740) has the molecular formula C19H22 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;2-methyl-2,3-dihydro-1H-indene.
| Compound Name | 2,3-dihydro-1H-indene;2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 159163740 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,3-dihydro-1H-indene;2-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2ccccc2C1.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H12.C9H10/c1-8-6-9-4-2-3-5-10(9)7-8;1-2-5-9-7-3-6-8(9)4-1/h2-5,8H,6-7H2,1H3;1-2,4-5H,3,6-7H2 |
| InChIKey | KKUVCNARKIPGEU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |