C11H15N — CID 57377025
(6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine (PubChem CID 57377025) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine.
| Compound Name | (6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine |
|---|---|
| PubChem CID | 57377025 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine |
| SMILES | N[C@H]1CCCc2ccccc2C1 |
| InChI | InChI=1S/C11H15N/c12-11-7-3-6-9-4-1-2-5-10(9)8-11/h1-2,4-5,11H,3,6-8,12H2/t11-/m0/s1 |
| InChIKey | MDVRGZASGHPBAG-NSHDSACASA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |