C10H16Cl3N — CID 67686398
1,2,3,4-tetrahydronaphthalen-2-amine;trihydrochloride (PubChem CID 67686398) has the molecular formula C10H16Cl3N and a molecular weight of 256.60 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-2-amine;trihydrochloride.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-2-amine;trihydrochloride |
|---|---|
| PubChem CID | 67686398 |
| Molecular Formula | C10H16Cl3N |
| Molecular Weight | 256.60 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-2-amine;trihydrochloride |
| SMILES | Cl.Cl.Cl.NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H13N.3ClH/c11-10-6-5-8-3-1-2-4-9(8)7-10;;;/h1-4,10H,5-7,11H2;3*1H |
| InChIKey | YVOHVQRVBSHTEQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |