C13H23N — CID 142154792
2,3-dihydro-1H-inden-2-amine;ethane (PubChem CID 142154792) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-amine;ethane.
| Compound Name | 2,3-dihydro-1H-inden-2-amine;ethane |
|---|---|
| PubChem CID | 142154792 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-amine;ethane |
| SMILES | CC.CC.NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C9H11N.2C2H6/c10-9-5-7-3-1-2-4-8(7)6-9;2*1-2/h1-4,9H,5-6,10H2;2*1-2H3 |
| InChIKey | FEPMBLVFYOMCMS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |