C12H18O — CID 91145840
2,3-dihydro-1H-inden-2-ylmethanol;ethane (PubChem CID 91145840) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-ylmethanol;ethane.
| Compound Name | 2,3-dihydro-1H-inden-2-ylmethanol;ethane |
|---|---|
| PubChem CID | 91145840 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-ylmethanol;ethane |
| SMILES | CC.OCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H12O.C2H6/c11-7-8-5-9-3-1-2-4-10(9)6-8;1-2/h1-4,8,11H,5-7H2;1-2H3 |
| InChIKey | FIDGLMYKVDNUHX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |