C12H15Br — CID 15752629
2-(2-bromoethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 15752629) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(2-bromoethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 15752629 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-(2-bromoethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | BrCCC1CCc2ccccc2C1 |
| InChI | InChI=1S/C12H15Br/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-4,10H,5-9H2 |
| InChIKey | QEXXRBYRJDXRED-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|