C11H15N — CID 86313684
[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methanamine (PubChem CID 86313684) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methanamine.
| Compound Name | [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methanamine |
|---|---|
| PubChem CID | 86313684 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methanamine |
| SMILES | NC[C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C11H15N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-4,9H,5-8,12H2/t9-/m0/s1 |
| InChIKey | WKQAFPKAFXIRCK-VIFPVBQESA-N |
| XLogP | 1.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |